C9H7NO3 — CID 5359943
5-hydroxy-3-methyl-1,4-benzoxazin-2-one (PubChem CID 5359943) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 5-hydroxy-3-methyl-1,4-benzoxazin-2-one.
| Compound Name | 5-hydroxy-3-methyl-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 5359943 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 5-hydroxy-3-methyl-1,4-benzoxazin-2-one |
| SMILES | Cc1nc2c(O)cccc2oc1=O |
| InChI | InChI=1S/C9H7NO3/c1-5-9(12)13-7-4-2-3-6(11)8(7)10-5/h2-4,11H,1H3 |
| InChIKey | NQNDQVHPEVROII-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |