About methyl propane-2-sulfinate
methyl propane-2-sulfinate (PubChem CID 536268) has the molecular formula C4H10O2S
and a molecular weight of 122.19 g/mol. Its IUPAC name is methyl propane-2-sulfinate.
Molecular Properties
| Compound Name | methyl propane-2-sulfinate |
| PubChem CID | 536268 |
| Molecular Formula | C4H10O2S |
| Molecular Weight | 122.19 g/mol |
| Exact Mass | 122.04 |
| IUPAC Name | methyl propane-2-sulfinate |
| SMILES | COS(=O)C(C)C |
| InChI | InChI=1S/C4H10O2S/c1-4(2)7(5)6-3/h4H,1-3H3 |
| InChIKey | AOZRDMYNXRQAAI-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze methyl propane-2-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl propane-2-sulfinate?
The IUPAC name of methyl propane-2-sulfinate (CID 536268) is methyl propane-2-sulfinate.
What is the SMILES notation for methyl propane-2-sulfinate?
The canonical SMILES for methyl propane-2-sulfinate is COS(=O)C(C)C.
What is the InChIKey of methyl propane-2-sulfinate?
The InChIKey is AOZRDMYNXRQAAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10O2S/c1-4(2)7(5)6-3/h4H,1-3H3.
What are the key properties of methyl propane-2-sulfinate?
methyl propane-2-sulfinate has a molecular weight of 122.19 g/mol, XLogP of 0.70, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl propane-2-sulfinate is sourced from PubChem (CID 536268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).