C8H10BrN3O — CID 536282
6-(bromomethyl)-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-amine (PubChem CID 536282) has the molecular formula C8H10BrN3O and a molecular weight of 244.09 g/mol. Its IUPAC name is 6-(bromomethyl)-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-amine.
| Compound Name | 6-(bromomethyl)-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 536282 |
| Molecular Formula | C8H10BrN3O |
| Molecular Weight | 244.09 g/mol |
| Exact Mass | 243.00 |
| IUPAC Name | 6-(bromomethyl)-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1nc(N)nc2c1CC(CBr)O2 |
| InChI | InChI=1S/C8H10BrN3O/c1-4-6-2-5(3-9)13-7(6)12-8(10)11-4/h5H,2-3H2,1H3,(H2,10,11,12) |
| InChIKey | ZYOFSORYWFMTTC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.09 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|