C7H8F6 — CID 5364828
(Z)-6,6,6-trifluoro-5-(trifluoromethyl)hex-2-ene (PubChem CID 5364828) has the molecular formula C7H8F6 and a molecular weight of 206.13 g/mol. Its IUPAC name is (Z)-6,6,6-trifluoro-5-(trifluoromethyl)hex-2-ene.
| Compound Name | (Z)-6,6,6-trifluoro-5-(trifluoromethyl)hex-2-ene |
|---|---|
| PubChem CID | 5364828 |
| Molecular Formula | C7H8F6 |
| Molecular Weight | 206.13 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | (Z)-6,6,6-trifluoro-5-(trifluoromethyl)hex-2-ene |
| SMILES | C/C=C\CC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C7H8F6/c1-2-3-4-5(6(8,9)10)7(11,12)13/h2-3,5H,4H2,1H3/b3-2- |
| InChIKey | UBBONQWCEYYSJE-IHWYPQMZSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.13 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|