C8H9F7 — CID 138396278
1,1,1,2,2,3,3-heptafluorooct-4-ene (PubChem CID 138396278) has the molecular formula C8H9F7 and a molecular weight of 238.15 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluorooct-4-ene.
| Compound Name | 1,1,1,2,2,3,3-heptafluorooct-4-ene |
|---|---|
| PubChem CID | 138396278 |
| Molecular Formula | C8H9F7 |
| Molecular Weight | 238.15 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluorooct-4-ene |
| SMILES | CCCC=CC(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H9F7/c1-2-3-4-5-6(9,10)7(11,12)8(13,14)15/h4-5H,2-3H2,1H3 |
| InChIKey | LGAFWMLLIBBCRX-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|