C18H34O4 — CID 5365393
1-[2,2-dimethyl-5-[(Z)-undec-1-enyl]-1,3-dioxolan-4-yl]ethane-1,2-diol (PubChem CID 5365393) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is 1-[2,2-dimethyl-5-[(Z)-undec-1-enyl]-1,3-dioxolan-4-yl]ethane-1,2-diol.
| Compound Name | 1-[2,2-dimethyl-5-[(Z)-undec-1-enyl]-1,3-dioxolan-4-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 5365393 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | 1-[2,2-dimethyl-5-[(Z)-undec-1-enyl]-1,3-dioxolan-4-yl]ethane-1,2-diol |
| SMILES | CCCCCCCCC/C=C\C1OC(C)(C)OC1C(O)CO |
| InChI | InChI=1S/C18H34O4/c1-4-5-6-7-8-9-10-11-12-13-16-17(15(20)14-19)22-18(2,3)21-16/h12-13,15-17,19-20H,4-11,14H2,1-3H3/b13-12- |
| InChIKey | KLVIKENMDAEWGE-SEYXRHQNSA-N |
| XLogP | 3.56 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|