C19H36OSi — CID 5366436
tert-butyl-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-enoxy]-dimethylsilane (PubChem CID 5366436) has the molecular formula C19H36OSi and a molecular weight of 308.58 g/mol. Its IUPAC name is tert-butyl-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 5366436 |
| Molecular Formula | C19H36OSi |
| Molecular Weight | 308.58 g/mol |
| Exact Mass | 308.25 |
| IUPAC Name | tert-butyl-[(E)-4-(2,2-dimethyl-6-methylidenecyclohexyl)but-1-enoxy]-dimethylsilane |
| SMILES | C=C1CCCC(C)(C)C1CC/C=C/O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H36OSi/c1-16-12-11-14-19(5,6)17(16)13-9-10-15-20-21(7,8)18(2,3)4/h10,15,17H,1,9,11-14H2,2-8H3/b15-10+ |
| InChIKey | VCAGZNMZBAUEJC-XNTDXEJSSA-N |
| XLogP | 6.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.58 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|