C23H42OSi — CID 11233807
3-[(1S,2R,6S)-1,2-dimethyl-6-prop-2-enylcyclohexyl]prop-1-ynoxy-tri(propan-2-yl)silane (PubChem CID 11233807) has the molecular formula C23H42OSi and a molecular weight of 362.67 g/mol. Its IUPAC name is 3-[(1S,2R,6S)-1,2-dimethyl-6-prop-2-enylcyclohexyl]prop-1-ynoxy-tri(propan-2-yl)silane.
| Compound Name | 3-[(1S,2R,6S)-1,2-dimethyl-6-prop-2-enylcyclohexyl]prop-1-ynoxy-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 11233807 |
| Molecular Formula | C23H42OSi |
| Molecular Weight | 362.67 g/mol |
| Exact Mass | 362.30 |
| IUPAC Name | 3-[(1S,2R,6S)-1,2-dimethyl-6-prop-2-enylcyclohexyl]prop-1-ynoxy-tri(propan-2-yl)silane |
| SMILES | C=CC[C@@H]1CCC[C@@H](C)[C@]1(C)CC#CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42OSi/c1-10-13-22-15-11-14-21(8)23(22,9)16-12-17-24-25(18(2)3,19(4)5)20(6)7/h10,18-22H,1,11,13-16H2,2-9H3/t21-,22-,23+/m1/s1 |
| InChIKey | OLXCLWBLGYEFRZ-ZLNRFVROSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.67 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|