C18H34OSi — CID 5366649
tert-butyl-[(Z)-3-(2,2-dimethyl-6-methylidenecyclohexyl)prop-1-enoxy]-dimethylsilane (PubChem CID 5366649) has the molecular formula C18H34OSi and a molecular weight of 294.56 g/mol. Its IUPAC name is tert-butyl-[(Z)-3-(2,2-dimethyl-6-methylidenecyclohexyl)prop-1-enoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(Z)-3-(2,2-dimethyl-6-methylidenecyclohexyl)prop-1-enoxy]-dimethylsilane |
|---|---|
| PubChem CID | 5366649 |
| Molecular Formula | C18H34OSi |
| Molecular Weight | 294.56 g/mol |
| Exact Mass | 294.24 |
| IUPAC Name | tert-butyl-[(Z)-3-(2,2-dimethyl-6-methylidenecyclohexyl)prop-1-enoxy]-dimethylsilane |
| SMILES | C=C1CCCC(C)(C)C1C/C=C\O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H34OSi/c1-15-11-9-13-18(5,6)16(15)12-10-14-19-20(7,8)17(2,3)4/h10,14,16H,1,9,11-13H2,2-8H3/b14-10- |
| InChIKey | AOGIIZUFWBNGIN-UVTDQMKNSA-N |
| XLogP | 6.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.56 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|