C17H28O3 — CID 5367913
oxan-2-yl (8Z,10Z)-dodeca-8,10-dienoate (PubChem CID 5367913) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is oxan-2-yl (8Z,10Z)-dodeca-8,10-dienoate.
| Compound Name | oxan-2-yl (8Z,10Z)-dodeca-8,10-dienoate |
|---|---|
| PubChem CID | 5367913 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | oxan-2-yl (8Z,10Z)-dodeca-8,10-dienoate |
| SMILES | C/C=C\C=C/CCCCCCC(=O)OC1CCCCO1 |
| InChI | InChI=1S/C17H28O3/c1-2-3-4-5-6-7-8-9-10-13-16(18)20-17-14-11-12-15-19-17/h2-5,17H,6-15H2,1H3/b3-2-,5-4- |
| InChIKey | RQPMVAHKMVTKDZ-LDIADDGTSA-N |
| XLogP | 4.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|