C23H40O4 — CID 171904922
(7Z,11Z)-18-(oxan-2-yloxy)octadeca-7,11-dienoic acid (PubChem CID 171904922) has the molecular formula C23H40O4 and a molecular weight of 380.57 g/mol. Its IUPAC name is (7Z,11Z)-18-(oxan-2-yloxy)octadeca-7,11-dienoic acid.
| Compound Name | (7Z,11Z)-18-(oxan-2-yloxy)octadeca-7,11-dienoic acid |
|---|---|
| PubChem CID | 171904922 |
| Molecular Formula | C23H40O4 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | (7Z,11Z)-18-(oxan-2-yloxy)octadeca-7,11-dienoic acid |
| SMILES | O=C(O)CCCCC/C=C\CC/C=C\CCCCCCOC1CCCCO1 |
| InChI | InChI=1S/C23H40O4/c24-22(25)18-14-12-10-8-6-4-2-1-3-5-7-9-11-13-16-20-26-23-19-15-17-21-27-23/h3-6,23H,1-2,7-21H2,(H,24,25)/b5-3-,6-4- |
| InChIKey | KSJXWHXAPUPZNT-GLIMQPGKSA-N |
| XLogP | 6.41 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|