C8H16N2 — CID 5367930
1,1-bis[(E)-but-2-enyl]hydrazine (PubChem CID 5367930) has the molecular formula C8H16N2 and a molecular weight of 140.23 g/mol. Its IUPAC name is 1,1-bis[(E)-but-2-enyl]hydrazine.
| Compound Name | 1,1-bis[(E)-but-2-enyl]hydrazine |
|---|---|
| PubChem CID | 5367930 |
| Molecular Formula | C8H16N2 |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.13 |
| IUPAC Name | 1,1-bis[(E)-but-2-enyl]hydrazine |
| SMILES | C/C=C/CN(N)C/C=C/C |
| InChI | InChI=1S/C8H16N2/c1-3-5-7-10(9)8-6-4-2/h3-6H,7-9H2,1-2H3/b5-3+,6-4+ |
| InChIKey | HCVMGJBOKUBGRJ-GGWOSOGESA-N |
| XLogP | 1.31 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|