C7H14N2 — CID 90250316
N-[(E)-but-2-enyl]-N,N'-dimethylmethanimidamide (PubChem CID 90250316) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-N,N'-dimethylmethanimidamide.
| Compound Name | N-[(E)-but-2-enyl]-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 90250316 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | N-[(E)-but-2-enyl]-N,N'-dimethylmethanimidamide |
| SMILES | C/C=C/CN(C)/C=N/C |
| InChI | InChI=1S/C7H14N2/c1-4-5-6-9(3)7-8-2/h4-5,7H,6H2,1-3H3/b5-4+,8-7+ |
| InChIKey | QPSYTGFHEZSTRU-AOSYACOCSA-N |
| XLogP | 1.15 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|