C8H19N3O — CID 176943743
N-[2-[2-hydroxyethyl(methyl)amino]ethyl]-N,N'-dimethylmethanimidamide (PubChem CID 176943743) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is N-[2-[2-hydroxyethyl(methyl)amino]ethyl]-N,N'-dimethylmethanimidamide.
| Compound Name | N-[2-[2-hydroxyethyl(methyl)amino]ethyl]-N,N'-dimethylmethanimidamide |
|---|---|
| PubChem CID | 176943743 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | N-[2-[2-hydroxyethyl(methyl)amino]ethyl]-N,N'-dimethylmethanimidamide |
| SMILES | C/N=C/N(C)CCN(C)CCO |
| InChI | InChI=1S/C8H19N3O/c1-9-8-11(3)5-4-10(2)6-7-12/h8,12H,4-7H2,1-3H3/b9-8+ |
| InChIKey | YUKKRTOIUDCSRQ-CMDGGOBGSA-N |
| XLogP | -0.50 |
| TPSA | 39.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|