About 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide
2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide (PubChem CID 88790453) has the molecular formula C11H16FeN7O
and a molecular weight of 318.14 g/mol. Its IUPAC name is 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide.
Molecular Properties
| Compound Name | 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide |
| PubChem CID | 88790453 |
| Molecular Formula | C11H16FeN7O |
| Molecular Weight | 318.14 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide |
| SMILES | CN(CCO)CCCN.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5] |
| InChI | InChI=1S/C6H16N2O.5CN.Fe/c1-8(5-6-9)4-2-3-7;5*1-2;/h9H,2-7H2,1H3;;;;;;/q;5*-1;+5 |
| InChIKey | GSZXMVDCZUBRIJ-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 168.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.14 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide?
The IUPAC name of 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide (CID 88790453) is 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide.
What is the SMILES notation for 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide?
The canonical SMILES for 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide is CN(CCO)CCCN.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[C-]#N.[Fe+5].
What is the InChIKey of 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide?
The InChIKey is GSZXMVDCZUBRIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H16N2O.5CN.Fe/c1-8(5-6-9)4-2-3-7;5*1-2;/h9H,2-7H2,1H3;;;;;;/q;5*-1;+5.
What are the key properties of 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide?
2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide has a molecular weight of 318.14 g/mol, XLogP of -0.26, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-aminopropyl(methyl)amino]ethanol;iron(5+);pentacyanide is sourced from PubChem (CID 88790453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).