C12H22O2 — CID 5367947
(2E,6E)-6-ethyldeca-2,6-diene-4,5-diol (PubChem CID 5367947) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (2E,6E)-6-ethyldeca-2,6-diene-4,5-diol.
| Compound Name | (2E,6E)-6-ethyldeca-2,6-diene-4,5-diol |
|---|---|
| PubChem CID | 5367947 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (2E,6E)-6-ethyldeca-2,6-diene-4,5-diol |
| SMILES | C/C=C/C(O)C(O)/C(=C/CCC)CC |
| InChI | InChI=1S/C12H22O2/c1-4-7-9-10(6-3)12(14)11(13)8-5-2/h5,8-9,11-14H,4,6-7H2,1-3H3/b8-5+,10-9+ |
| InChIKey | RWSQJPCFDCSSBT-CPSCNVPRSA-N |
| XLogP | 2.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|