C32H26O4 — CID 5368373
2-[(E)-2-[3,5-bis(phenylmethoxy)phenyl]ethenyl]-3-methylchromen-4-one (PubChem CID 5368373) has the molecular formula C32H26O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is 2-[(E)-2-[3,5-bis(phenylmethoxy)phenyl]ethenyl]-3-methylchromen-4-one.
| Compound Name | 2-[(E)-2-[3,5-bis(phenylmethoxy)phenyl]ethenyl]-3-methylchromen-4-one |
|---|---|
| PubChem CID | 5368373 |
| Molecular Formula | C32H26O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | 2-[(E)-2-[3,5-bis(phenylmethoxy)phenyl]ethenyl]-3-methylchromen-4-one |
| SMILES | Cc1c(/C=C/c2cc(OCc3ccccc3)cc(OCc3ccccc3)c2)oc2ccccc2c1=O |
| InChI | InChI=1S/C32H26O4/c1-23-30(36-31-15-9-8-14-29(31)32(23)33)17-16-26-18-27(34-21-24-10-4-2-5-11-24)20-28(19-26)35-22-25-12-6-3-7-13-25/h2-20H,21-22H2,1H3/b17-16+ |
| InChIKey | DHSWRQMRGIDUJX-WUKNDPDISA-N |
| XLogP | 7.43 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |