C13H18O4 — CID 5370424
methyl (E)-4-oxo-4-(1,2,2-trimethyl-5-oxocyclopentyl)but-2-enoate (PubChem CID 5370424) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is methyl (E)-4-oxo-4-(1,2,2-trimethyl-5-oxocyclopentyl)but-2-enoate.
| Compound Name | methyl (E)-4-oxo-4-(1,2,2-trimethyl-5-oxocyclopentyl)but-2-enoate |
|---|---|
| PubChem CID | 5370424 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | methyl (E)-4-oxo-4-(1,2,2-trimethyl-5-oxocyclopentyl)but-2-enoate |
| SMILES | COC(=O)/C=C/C(=O)C1(C)C(=O)CCC1(C)C |
| InChI | InChI=1S/C13H18O4/c1-12(2)8-7-10(15)13(12,3)9(14)5-6-11(16)17-4/h5-6H,7-8H2,1-4H3/b6-5+ |
| InChIKey | MNXLUMOGVGIMRM-AATRIKPKSA-N |
| XLogP | 1.68 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|