C14H20O4 — CID 5375263
methyl 2-[(E)-3-methoxy-3-oxoprop-1-enyl]-3,3-dimethyl-4-methylidenecyclopentane-1-carboxylate (PubChem CID 5375263) has the molecular formula C14H20O4 and a molecular weight of 252.31 g/mol. Its IUPAC name is methyl 2-[(E)-3-methoxy-3-oxoprop-1-enyl]-3,3-dimethyl-4-methylidenecyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(E)-3-methoxy-3-oxoprop-1-enyl]-3,3-dimethyl-4-methylidenecyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 5375263 |
| Molecular Formula | C14H20O4 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | methyl 2-[(E)-3-methoxy-3-oxoprop-1-enyl]-3,3-dimethyl-4-methylidenecyclopentane-1-carboxylate |
| SMILES | C=C1CC(C(=O)OC)C(/C=C/C(=O)OC)C1(C)C |
| InChI | InChI=1S/C14H20O4/c1-9-8-10(13(16)18-5)11(14(9,2)3)6-7-12(15)17-4/h6-7,10-11H,1,8H2,2-5H3/b7-6+ |
| InChIKey | XQFDOEMZEADBOW-VOTSOKGWSA-N |
| XLogP | 2.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|