C13H13NO4 — CID 5383479
6-methoxy-2,3-dimethyl-5-[(Z)-2-nitroethenyl]-1-benzofuran (PubChem CID 5383479) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is 6-methoxy-2,3-dimethyl-5-[(Z)-2-nitroethenyl]-1-benzofuran.
| Compound Name | 6-methoxy-2,3-dimethyl-5-[(Z)-2-nitroethenyl]-1-benzofuran |
|---|---|
| PubChem CID | 5383479 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | 6-methoxy-2,3-dimethyl-5-[(Z)-2-nitroethenyl]-1-benzofuran |
| SMILES | COc1cc2oc(C)c(C)c2cc1/C=C\[N+](=O)[O-] |
| InChI | InChI=1S/C13H13NO4/c1-8-9(2)18-13-7-12(17-3)10(6-11(8)13)4-5-14(15)16/h4-7H,1-3H3/b5-4- |
| InChIKey | YUJGTLDNFVUXKB-PLNGDYQASA-N |
| XLogP | 3.31 |
| TPSA | 65.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|