C13H15NO4S — CID 71377951
1,4-dimethoxy-2-(2-nitroethenyl)-5-prop-2-enylsulfanylbenzene (PubChem CID 71377951) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(2-nitroethenyl)-5-prop-2-enylsulfanylbenzene.
| Compound Name | 1,4-dimethoxy-2-(2-nitroethenyl)-5-prop-2-enylsulfanylbenzene |
|---|---|
| PubChem CID | 71377951 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 1,4-dimethoxy-2-(2-nitroethenyl)-5-prop-2-enylsulfanylbenzene |
| SMILES | C=CCSc1cc(OC)c(C=C[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C13H15NO4S/c1-4-7-19-13-9-11(17-2)10(5-6-14(15)16)8-12(13)18-3/h4-6,8-9H,1,7H2,2-3H3 |
| InChIKey | FFSAMKINOJLNLN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|