C12H15FO3S — CID 12063238
4-(3-fluoropropylsulfanyl)-2,5-dimethoxybenzaldehyde (PubChem CID 12063238) has the molecular formula C12H15FO3S and a molecular weight of 258.31 g/mol. Its IUPAC name is 4-(3-fluoropropylsulfanyl)-2,5-dimethoxybenzaldehyde.
| Compound Name | 4-(3-fluoropropylsulfanyl)-2,5-dimethoxybenzaldehyde |
|---|---|
| PubChem CID | 12063238 |
| Molecular Formula | C12H15FO3S |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 4-(3-fluoropropylsulfanyl)-2,5-dimethoxybenzaldehyde |
| SMILES | COc1cc(SCCCF)c(OC)cc1C=O |
| InChI | InChI=1S/C12H15FO3S/c1-15-10-7-12(17-5-3-4-13)11(16-2)6-9(10)8-14/h6-8H,3-5H2,1-2H3 |
| InChIKey | CVLVLPRBPHJADD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|