C10H17NO4 — CID 538350
N-(2,3-dimethoxy-4-oxocyclohexyl)acetamide (PubChem CID 538350) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is N-(2,3-dimethoxy-4-oxocyclohexyl)acetamide.
| Compound Name | N-(2,3-dimethoxy-4-oxocyclohexyl)acetamide |
|---|---|
| PubChem CID | 538350 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | N-(2,3-dimethoxy-4-oxocyclohexyl)acetamide |
| SMILES | COC1C(=O)CCC(NC(C)=O)C1OC |
| InChI | InChI=1S/C10H17NO4/c1-6(12)11-7-4-5-8(13)10(15-3)9(7)14-2/h7,9-10H,4-5H2,1-3H3,(H,11,12) |
| InChIKey | TWMKFXRMYOBOPJ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |