C8H12BrNO2 — CID 97107697
N-[(1R,3R)-3-bromo-4-oxocyclohexyl]acetamide (PubChem CID 97107697) has the molecular formula C8H12BrNO2 and a molecular weight of 234.09 g/mol. Its IUPAC name is N-[(1R,3R)-3-bromo-4-oxocyclohexyl]acetamide.
| Compound Name | N-[(1R,3R)-3-bromo-4-oxocyclohexyl]acetamide |
|---|---|
| PubChem CID | 97107697 |
| Molecular Formula | C8H12BrNO2 |
| Molecular Weight | 234.09 g/mol |
| Exact Mass | 233.01 |
| IUPAC Name | N-[(1R,3R)-3-bromo-4-oxocyclohexyl]acetamide |
| SMILES | CC(=O)N[C@@H]1CCC(=O)[C@H](Br)C1 |
| InChI | InChI=1S/C8H12BrNO2/c1-5(11)10-6-2-3-8(12)7(9)4-6/h6-7H,2-4H2,1H3,(H,10,11)/t6-,7-/m1/s1 |
| InChIKey | WBTGJPGTKKCSKY-RNFRBKRXSA-N |
| XLogP | 1.01 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.09 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|