C13H15ClO2 — CID 5384034
(E)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid (PubChem CID 5384034) has the molecular formula C13H15ClO2 and a molecular weight of 238.71 g/mol. Its IUPAC name is (E)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid.
| Compound Name | (E)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid |
|---|---|
| PubChem CID | 5384034 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (E)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid |
| SMILES | C/C(=C\c1ccc(Cl)cc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H15ClO2/c1-9(13(2,3)12(15)16)8-10-4-6-11(14)7-5-10/h4-8H,1-3H3,(H,15,16)/b9-8+ |
| InChIKey | ZUJSAJQUBXASPX-CMDGGOBGSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |