About (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid
(Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid (PubChem CID 98061190) has the molecular formula C13H15ClO2
and a molecular weight of 238.71 g/mol. Its IUPAC name is (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid.
Molecular Properties
| Compound Name | (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid |
| PubChem CID | 98061190 |
| Molecular Formula | C13H15ClO2 |
| Molecular Weight | 238.71 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid |
| SMILES | C/C(=C/c1ccc(Cl)cc1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C13H15ClO2/c1-9(13(2,3)12(15)16)8-10-4-6-11(14)7-5-10/h4-8H,1-3H3,(H,15,16)/b9-8- |
| InChIKey | ZUJSAJQUBXASPX-HJWRWDBZSA-N |
| XLogP | 3.85 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.71 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid?
The IUPAC name of (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid (CID 98061190) is (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid.
What is the SMILES notation for (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid?
The canonical SMILES for (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid is C/C(=C/c1ccc(Cl)cc1)C(C)(C)C(=O)O.
What is the InChIKey of (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid?
The InChIKey is ZUJSAJQUBXASPX-HJWRWDBZSA-N. The full InChI is InChI=1S/C13H15ClO2/c1-9(13(2,3)12(15)16)8-10-4-6-11(14)7-5-10/h4-8H,1-3H3,(H,15,16)/b9-8-.
What are the key properties of (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid?
(Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid has a molecular weight of 238.71 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-4-(4-chlorophenyl)-2,2,3-trimethylbut-3-enoic acid is sourced from PubChem (CID 98061190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).