C18H25ClN2O2 — CID 18859954
N-[(E)-1-(4-chlorophenyl)-3-(diethylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide (PubChem CID 18859954) has the molecular formula C18H25ClN2O2 and a molecular weight of 336.86 g/mol. Its IUPAC name is N-[(E)-1-(4-chlorophenyl)-3-(diethylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(E)-1-(4-chlorophenyl)-3-(diethylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 18859954 |
| Molecular Formula | C18H25ClN2O2 |
| Molecular Weight | 336.86 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | N-[(E)-1-(4-chlorophenyl)-3-(diethylamino)-3-oxoprop-1-en-2-yl]-2,2-dimethylpropanamide |
| SMILES | CCN(CC)C(=O)/C(=C\c1ccc(Cl)cc1)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H25ClN2O2/c1-6-21(7-2)16(22)15(20-17(23)18(3,4)5)12-13-8-10-14(19)11-9-13/h8-12H,6-7H2,1-5H3,(H,20,23)/b15-12+ |
| InChIKey | JFWWRPYZBSXWMU-NTCAYCPXSA-N |
| XLogP | 3.71 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.86 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|