C18H11ClN2O3S4 — CID 5384158
[(E)-[2-(2-methoxyphenyl)-3-sulfanylidene-1,4,2-dithiazolidin-5-ylidene]amino] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 5384158) has the molecular formula C18H11ClN2O3S4 and a molecular weight of 467.02 g/mol. Its IUPAC name is [(E)-[2-(2-methoxyphenyl)-3-sulfanylidene-1,4,2-dithiazolidin-5-ylidene]amino] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [(E)-[2-(2-methoxyphenyl)-3-sulfanylidene-1,4,2-dithiazolidin-5-ylidene]amino] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 5384158 |
| Molecular Formula | C18H11ClN2O3S4 |
| Molecular Weight | 467.02 g/mol |
| Exact Mass | 465.93 |
| IUPAC Name | [(E)-[2-(2-methoxyphenyl)-3-sulfanylidene-1,4,2-dithiazolidin-5-ylidene]amino] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | COc1ccccc1-n1s/c(=N/OC(=O)c2sc3ccccc3c2Cl)sc1=S |
| InChI | InChI=1S/C18H11ClN2O3S4/c1-23-12-8-4-3-7-11(12)21-18(25)27-17(28-21)20-24-16(22)15-14(19)10-6-2-5-9-13(10)26-15/h2-9H,1H3/b20-17+ |
| InChIKey | CBUMZXDSQCEHBF-LVZFUZTISA-N |
| XLogP | 5.88 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.02 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|