C25H41NO3Si — CID 538486
[8-(3-cyano-3-trimethylsilyloxypropyl)-4a,7-dimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate (PubChem CID 538486) has the molecular formula C25H41NO3Si and a molecular weight of 431.69 g/mol. Its IUPAC name is [8-(3-cyano-3-trimethylsilyloxypropyl)-4a,7-dimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate.
| Compound Name | [8-(3-cyano-3-trimethylsilyloxypropyl)-4a,7-dimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate |
|---|---|
| PubChem CID | 538486 |
| Molecular Formula | C25H41NO3Si |
| Molecular Weight | 431.69 g/mol |
| Exact Mass | 431.29 |
| IUPAC Name | [8-(3-cyano-3-trimethylsilyloxypropyl)-4a,7-dimethyl-2,3,4,4b,5,6,8a,9,10,10a-decahydro-1H-phenanthren-2-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C(CCC3C(CCC(C#N)O[Si](C)(C)C)=C(C)CCC32)C1 |
| InChI | InChI=1S/C25H41NO3Si/c1-17-7-12-24-23(22(17)11-9-21(16-26)29-30(4,5)6)10-8-19-15-20(28-18(2)27)13-14-25(19,24)3/h19-21,23-24H,7-15H2,1-6H3 |
| InChIKey | IMJJWPJZOHNTNJ-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.69 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|