C11H16O2 — CID 538547
undeca-3,4-diene-2,10-dione (PubChem CID 538547) has the molecular formula C11H16O2 and a molecular weight of 180.25 g/mol. Its IUPAC name is undeca-3,4-diene-2,10-dione.
| Compound Name | undeca-3,4-diene-2,10-dione |
|---|---|
| PubChem CID | 538547 |
| Molecular Formula | C11H16O2 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.12 |
| IUPAC Name | undeca-3,4-diene-2,10-dione |
| SMILES | CC(=O)C=C=CCCCCC(C)=O |
| InChI | InChI=1S/C11H16O2/c1-10(12)8-6-4-3-5-7-9-11(2)13/h4,8H,3,5,7,9H2,1-2H3 |
| InChIKey | HEXGHBSSLNIGCT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|