C32H44Cl2N2O3 — CID 5387110
[(4bR,8S,10aS,12aS)-10a,12a-dimethyl-2-oxo-3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-tetradecahydro-1H-naphtho[2,1-f]quinolin-8-yl] (Z)-3-[3-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate (PubChem CID 5387110) has the molecular formula C32H44Cl2N2O3 and a molecular weight of 575.62 g/mol. Its IUPAC name is [(4bR,8S,10aS,12aS)-10a,12a-dimethyl-2-oxo-3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-tetradecahydro-1H-naphtho[2,1-f]quinolin-8-yl] (Z)-3-[3-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate.
| Compound Name | [(4bR,8S,10aS,12aS)-10a,12a-dimethyl-2-oxo-3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-tetradecahydro-1H-naphtho[2,1-f]quinolin-8-yl] (Z)-3-[3-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 5387110 |
| Molecular Formula | C32H44Cl2N2O3 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | [(4bR,8S,10aS,12aS)-10a,12a-dimethyl-2-oxo-3,4,4a,4b,5,6,6a,7,8,9,10,10b,11,12-tetradecahydro-1H-naphtho[2,1-f]quinolin-8-yl] (Z)-3-[3-[bis(2-chloroethyl)amino]phenyl]prop-2-enoate |
| SMILES | C[C@]12CC[C@H](OC(=O)/C=C\c3cccc(N(CCCl)CCCl)c3)CC1CC[C@@H]1C2CC[C@]2(C)NC(=O)CCC12 |
| InChI | InChI=1S/C32H44Cl2N2O3/c1-31-14-12-25(39-30(38)11-6-22-4-3-5-24(20-22)36(18-16-33)19-17-34)21-23(31)7-8-26-27(31)13-15-32(2)28(26)9-10-29(37)35-32/h3-6,11,20,23,25-28H,7-10,12-19,21H2,1-2H3,(H,35,37)/b11-6-/t23?,25-,26+,27?,28?,31-,32-/m0/s1 |
| InChIKey | MJJQETZDTOSLSA-YIXDZZBFSA-N |
| XLogP | 6.81 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|