C13H16O3 — CID 53892396
3,4,4a,5,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione (PubChem CID 53892396) has the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. Its IUPAC name is 3,4,4a,5,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione.
| Compound Name | 3,4,4a,5,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione |
|---|---|
| PubChem CID | 53892396 |
| Molecular Formula | C13H16O3 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.11 |
| IUPAC Name | 3,4,4a,5,8a,9,9a,10a-octahydro-2H-xanthene-1,8-dione |
| SMILES | C1CC2C(CC3C(O2)CC=CC3=O)C(=O)C1 |
| InChI | InChI=1S/C13H16O3/c14-10-3-1-5-12-8(10)7-9-11(15)4-2-6-13(9)16-12/h1,3,8-9,12-13H,2,4-7H2 |
| InChIKey | HRJUHORWGGUVGV-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | 358 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |