About (2,5-dioxooxolan-3-yl) acetate
(2,5-dioxooxolan-3-yl) acetate (PubChem CID 539491) has the molecular formula C6H6O5
and a molecular weight of 158.11 g/mol. Its IUPAC name is (2,5-dioxooxolan-3-yl) acetate.
Molecular Properties
| Compound Name | (2,5-dioxooxolan-3-yl) acetate |
| PubChem CID | 539491 |
| Molecular Formula | C6H6O5 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.02 |
| IUPAC Name | (2,5-dioxooxolan-3-yl) acetate |
| SMILES | CC(=O)OC1CC(=O)OC1=O |
| InChI | InChI=1S/C6H6O5/c1-3(7)10-4-2-5(8)11-6(4)9/h4H,2H2,1H3 |
| InChIKey | SSWJHSASZZAIAU-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2,5-dioxooxolan-3-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,5-dioxooxolan-3-yl) acetate?
The IUPAC name of (2,5-dioxooxolan-3-yl) acetate (CID 539491) is (2,5-dioxooxolan-3-yl) acetate.
What is the SMILES notation for (2,5-dioxooxolan-3-yl) acetate?
The canonical SMILES for (2,5-dioxooxolan-3-yl) acetate is CC(=O)OC1CC(=O)OC1=O.
What is the InChIKey of (2,5-dioxooxolan-3-yl) acetate?
The InChIKey is SSWJHSASZZAIAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O5/c1-3(7)10-4-2-5(8)11-6(4)9/h4H,2H2,1H3.
What are the key properties of (2,5-dioxooxolan-3-yl) acetate?
(2,5-dioxooxolan-3-yl) acetate has a molecular weight of 158.11 g/mol, XLogP of -0.61, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2,5-dioxooxolan-3-yl) acetate is sourced from PubChem (CID 539491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).