C19H18O4 — CID 5398995
3-(3,5-dimethylphenoxy)-2-ethyl-7-hydroxychromen-4-one (PubChem CID 5398995) has the molecular formula C19H18O4 and a molecular weight of 310.35 g/mol. Its IUPAC name is 3-(3,5-dimethylphenoxy)-2-ethyl-7-hydroxychromen-4-one.
| Compound Name | 3-(3,5-dimethylphenoxy)-2-ethyl-7-hydroxychromen-4-one |
|---|---|
| PubChem CID | 5398995 |
| Molecular Formula | C19H18O4 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 3-(3,5-dimethylphenoxy)-2-ethyl-7-hydroxychromen-4-one |
| SMILES | CCc1oc2cc(O)ccc2c(=O)c1Oc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C19H18O4/c1-4-16-19(22-14-8-11(2)7-12(3)9-14)18(21)15-6-5-13(20)10-17(15)23-16/h5-10,20H,4H2,1-3H3 |
| InChIKey | WFOZHXIZZMCPFM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |