C22H28N4O2 — CID 54000431
2-[4-(7-methylspiro[1,3-benzodioxole-2,1'-cycloheptane]-5-yl)piperazin-1-yl]pyrimidine (PubChem CID 54000431) has the molecular formula C22H28N4O2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[4-(7-methylspiro[1,3-benzodioxole-2,1'-cycloheptane]-5-yl)piperazin-1-yl]pyrimidine.
| Compound Name | 2-[4-(7-methylspiro[1,3-benzodioxole-2,1'-cycloheptane]-5-yl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 54000431 |
| Molecular Formula | C22H28N4O2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 2-[4-(7-methylspiro[1,3-benzodioxole-2,1'-cycloheptane]-5-yl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1cc(N2CCN(c3ncccn3)CC2)cc2c1OC1(CCCCCC1)O2 |
| InChI | InChI=1S/C22H28N4O2/c1-17-15-18(25-11-13-26(14-12-25)21-23-9-6-10-24-21)16-19-20(17)28-22(27-19)7-4-2-3-5-8-22/h6,9-10,15-16H,2-5,7-8,11-14H2,1H3 |
| InChIKey | KLEODUSIWQEWAB-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|