C7H8NO5+ — CID 54000787
3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoic acid (PubChem CID 54000787) has the molecular formula C7H8NO5+ and a molecular weight of 186.14 g/mol. Its IUPAC name is 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoic acid.
| Compound Name | 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 54000787 |
| Molecular Formula | C7H8NO5+ |
| Molecular Weight | 186.14 g/mol |
| Exact Mass | 186.04 |
| IUPAC Name | 3-(1-hydroxy-2,5-dioxopyrrolidin-1-ium-1-yl)prop-2-enoic acid |
| SMILES | O=C(O)C=C[N+]1(O)C(=O)CCC1=O |
| InChI | InChI=1S/C7H7NO5/c9-5-1-2-6(10)8(5,13)4-3-7(11)12/h3-4,13H,1-2H2/p+1 |
| InChIKey | IINSGORJDHKMAK-UHFFFAOYSA-O |
| XLogP | -0.36 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.14 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|