C17H37O3P — CID 54001139
7,9-dimethylpentadecan-8-ylphosphonic acid (PubChem CID 54001139) has the molecular formula C17H37O3P and a molecular weight of 320.45 g/mol. Its IUPAC name is 7,9-dimethylpentadecan-8-ylphosphonic acid.
| Compound Name | 7,9-dimethylpentadecan-8-ylphosphonic acid |
|---|---|
| PubChem CID | 54001139 |
| Molecular Formula | C17H37O3P |
| Molecular Weight | 320.45 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | 7,9-dimethylpentadecan-8-ylphosphonic acid |
| SMILES | CCCCCCC(C)C(C(C)CCCCCC)P(=O)(O)O |
| InChI | InChI=1S/C17H37O3P/c1-5-7-9-11-13-15(3)17(21(18,19)20)16(4)14-12-10-8-6-2/h15-17H,5-14H2,1-4H3,(H2,18,19,20) |
| InChIKey | KLRPRPYIQQYROC-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.45 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|