C14H12ClF3N2O4 — CID 540030
methyl 3-(3-chloro-2-oxo-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate (PubChem CID 540030) has the molecular formula C14H12ClF3N2O4 and a molecular weight of 364.71 g/mol. Its IUPAC name is methyl 3-(3-chloro-2-oxo-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate.
| Compound Name | methyl 3-(3-chloro-2-oxo-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
|---|---|
| PubChem CID | 540030 |
| Molecular Formula | C14H12ClF3N2O4 |
| Molecular Weight | 364.71 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | methyl 3-(3-chloro-2-oxo-1H-indol-3-yl)-2-[(2,2,2-trifluoroacetyl)amino]propanoate |
| SMILES | COC(=O)C(CC1(Cl)C(=O)Nc2ccccc21)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C14H12ClF3N2O4/c1-24-10(21)9(20-12(23)14(16,17)18)6-13(15)7-4-2-3-5-8(7)19-11(13)22/h2-5,9H,6H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | XHCQIUFAWJOLAI-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.71 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|