C14H12Cl3NO — CID 54003137
2-chloro-2-(2,4-dichlorophenyl)-1-(2-methyl-3-pyridinyl)ethanol (PubChem CID 54003137) has the molecular formula C14H12Cl3NO and a molecular weight of 316.62 g/mol. Its IUPAC name is 2-chloro-2-(2,4-dichlorophenyl)-1-(2-methyl-3-pyridinyl)ethanol.
| Compound Name | 2-chloro-2-(2,4-dichlorophenyl)-1-(2-methyl-3-pyridinyl)ethanol |
|---|---|
| PubChem CID | 54003137 |
| Molecular Formula | C14H12Cl3NO |
| Molecular Weight | 316.62 g/mol |
| Exact Mass | 315.00 |
| IUPAC Name | 2-chloro-2-(2,4-dichlorophenyl)-1-(2-methyl-3-pyridinyl)ethanol |
| SMILES | Cc1ncccc1C(O)C(Cl)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H12Cl3NO/c1-8-10(3-2-6-18-8)14(19)13(17)11-5-4-9(15)7-12(11)16/h2-7,13-14,19H,1H3 |
| InChIKey | KMZYEGWMMZHZDF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|