C32H50O2 — CID 54003299
[(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-ethynyldodecanoate (PubChem CID 54003299) has the molecular formula C32H50O2 and a molecular weight of 466.75 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-ethynyldodecanoate.
| Compound Name | [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-ethynyldodecanoate |
|---|---|
| PubChem CID | 54003299 |
| Molecular Formula | C32H50O2 |
| Molecular Weight | 466.75 g/mol |
| Exact Mass | 466.38 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-ethynyldodecanoate |
| SMILES | C#CC(CCCCCCCCCC)C(=O)OC1=CC[C@H]2C(CC[C@@H]3[C@@H]2CC[C@]2(C)CCC[C@@H]32)C1 |
| InChI | InChI=1S/C32H50O2/c1-4-6-7-8-9-10-11-12-14-24(5-2)31(33)34-26-17-19-27-25(23-26)16-18-29-28(27)20-22-32(3)21-13-15-30(29)32/h2,17,24-25,27-30H,4,6-16,18-23H2,1,3H3/t24?,25?,27-,28+,29+,30-,32-/m0/s1 |
| InChIKey | KNCZWIYYGKCOIK-KMAAGXGASA-N |
| XLogP | 8.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|