C22H34O2 — CID 154478934
[(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate (PubChem CID 154478934) has the molecular formula C22H34O2 and a molecular weight of 330.51 g/mol. Its IUPAC name is [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate.
| Compound Name | [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 154478934 |
| Molecular Formula | C22H34O2 |
| Molecular Weight | 330.51 g/mol |
| Exact Mass | 330.26 |
| IUPAC Name | [(8R,9R,10S,13S,14S)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3-yl] 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC1=CC[C@H]2C(CC[C@@H]3[C@@H]2CC[C@]2(C)CCC[C@@H]32)C1 |
| InChI | InChI=1S/C22H34O2/c1-14(2)21(23)24-16-7-9-17-15(13-16)6-8-19-18(17)10-12-22(3)11-4-5-20(19)22/h7,14-15,17-20H,4-6,8-13H2,1-3H3/t15?,17-,18+,19+,20-,22-/m0/s1 |
| InChIKey | HXKVMLKAQPRHSC-FXKFIDAZSA-N |
| XLogP | 5.72 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.51 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |