C24H34O2 — CID 54518217
2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 2-methylpropanoate (PubChem CID 54518217) has the molecular formula C24H34O2 and a molecular weight of 354.53 g/mol. Its IUPAC name is 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 2-methylpropanoate.
| Compound Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 2-methylpropanoate |
|---|---|
| PubChem CID | 54518217 |
| Molecular Formula | C24H34O2 |
| Molecular Weight | 354.53 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-[(8R,9R,10S,13S,14S,17R)-13-methyl-1,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-17-yl]ethynyl 2-methylpropanoate |
| SMILES | CC(C)C(=O)OC#C[C@@H]1CC[C@H]2[C@@H]3CCC4CC=CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C24H34O2/c1-16(2)23(25)26-15-13-18-9-11-22-21-10-8-17-6-4-5-7-19(17)20(21)12-14-24(18,22)3/h4-5,16-22H,6-12,14H2,1-3H3/t17?,18-,19-,20+,21+,22-,24+/m0/s1 |
| InChIKey | YNXBOMFLEGUEEF-WPRMDOOLSA-N |
| XLogP | 5.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.53 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|