C11H11Cl3N2O5S — CID 54003467
2,2,2-trichloroethyl (6S)-7-formamido-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54003467) has the molecular formula C11H11Cl3N2O5S and a molecular weight of 389.64 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6S)-7-formamido-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6S)-7-formamido-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54003467 |
| Molecular Formula | C11H11Cl3N2O5S |
| Molecular Weight | 389.64 g/mol |
| Exact Mass | 387.95 |
| IUPAC Name | 2,2,2-trichloroethyl (6S)-7-formamido-3-methyl-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CC1=C(C(=O)OCC(Cl)(Cl)Cl)N2C(=O)C(NC=O)[C@@H]2S(=O)C1 |
| InChI | InChI=1S/C11H11Cl3N2O5S/c1-5-2-22(20)9-6(15-4-17)8(18)16(9)7(5)10(19)21-3-11(12,13)14/h4,6,9H,2-3H2,1H3,(H,15,17)/t6?,9-,22?/m0/s1 |
| InChIKey | KNFXYEDIDAFTDP-BKGQXJTLSA-N |
| XLogP | 0.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.64 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|