C11H9Br2Cl3N2O5S — CID 88774939
2,2,2-trichloroethyl (6R)-4-bromo-3-(bromomethyl)-7-formamido-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 88774939) has the molecular formula C11H9Br2Cl3N2O5S and a molecular weight of 547.44 g/mol. Its IUPAC name is 2,2,2-trichloroethyl (6R)-4-bromo-3-(bromomethyl)-7-formamido-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 2,2,2-trichloroethyl (6R)-4-bromo-3-(bromomethyl)-7-formamido-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 88774939 |
| Molecular Formula | C11H9Br2Cl3N2O5S |
| Molecular Weight | 547.44 g/mol |
| Exact Mass | 543.77 |
| IUPAC Name | 2,2,2-trichloroethyl (6R)-4-bromo-3-(bromomethyl)-7-formamido-5,8-dioxo-5λ4-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=CNC1C(=O)N2C(C(=O)OCC(Cl)(Cl)Cl)=C(CBr)C(Br)S(=O)[C@H]12 |
| InChI | InChI=1S/C11H9Br2Cl3N2O5S/c12-1-4-6(10(21)23-2-11(14,15)16)18-8(20)5(17-3-19)9(18)24(22)7(4)13/h3,5,7,9H,1-2H2,(H,17,19)/t5?,7?,9-,24?/m1/s1 |
| InChIKey | GMNZITJREHAHAF-NHYORVMMSA-N |
| XLogP | 1.32 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.44 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|