About CID 54005811
CID 54005811 (PubChem CID 54005811) has the molecular formula C26H20P2S4
and a molecular weight of 522.66 g/mol.
Molecular Properties
| Compound Name | CID 54005811 |
| PubChem CID | 54005811 |
| Molecular Formula | C26H20P2S4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 521.99 |
| IUPAC Name | — |
| SMILES | S=P(=S)C(c1ccccc1)(c1ccccc1)C(c1ccccc1)(c1ccccc1)P(=S)=S |
| InChI | InChI=1S/C26H20P2S4/c29-27(30)25(21-13-5-1-6-14-21,22-15-7-2-8-16-22)26(28(31)32,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H |
| InChIKey | KOUQHURSJSKFPO-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 54005811 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 54005811?
The IUPAC name of CID 54005811 (CID 54005811) is not available.
What is the SMILES notation for CID 54005811?
The canonical SMILES for CID 54005811 is S=P(=S)C(c1ccccc1)(c1ccccc1)C(c1ccccc1)(c1ccccc1)P(=S)=S.
What is the InChIKey of CID 54005811?
The InChIKey is KOUQHURSJSKFPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20P2S4/c29-27(30)25(21-13-5-1-6-14-21,22-15-7-2-8-16-22)26(28(31)32,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H.
What are the key properties of CID 54005811?
CID 54005811 has a molecular weight of 522.66 g/mol, XLogP of 7.69, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 54005811 is sourced from PubChem (CID 54005811), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).