C19H34O8 — CID 54006328
[(3aS,4R,6R,7R,7aS)-2,2,6-trimethyl-4-(methylperoxymethyl)-6-propan-2-yloxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] 2,2-dimethylpropanoate (PubChem CID 54006328) has the molecular formula C19H34O8 and a molecular weight of 390.47 g/mol. Its IUPAC name is [(3aS,4R,6R,7R,7aS)-2,2,6-trimethyl-4-(methylperoxymethyl)-6-propan-2-yloxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3aS,4R,6R,7R,7aS)-2,2,6-trimethyl-4-(methylperoxymethyl)-6-propan-2-yloxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54006328 |
| Molecular Formula | C19H34O8 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.23 |
| IUPAC Name | [(3aS,4R,6R,7R,7aS)-2,2,6-trimethyl-4-(methylperoxymethyl)-6-propan-2-yloxy-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] 2,2-dimethylpropanoate |
| SMILES | COOC[C@H]1O[C@@](C)(OC(C)C)[C@H](OC(=O)C(C)(C)C)[C@H]2OC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C19H34O8/c1-11(2)24-19(8)15(23-16(20)17(3,4)5)14-13(26-18(6,7)27-14)12(25-19)10-22-21-9/h11-15H,10H2,1-9H3/t12-,13+,14+,15-,19-/m1/s1 |
| InChIKey | KPDDJILUFDDOSR-QHGRHRLRSA-N |
| XLogP | 2.58 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|