C20H26N4O10S — CID 54008960
2-[3-(2-hydroxyethylamino)-4-nitrophenyl]-2-[2-hydroxy-1-[3-(2-hydroxyethylamino)-4-nitrophenyl]ethyl]sulfonylethanol (PubChem CID 54008960) has the molecular formula C20H26N4O10S and a molecular weight of 514.51 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethylamino)-4-nitrophenyl]-2-[2-hydroxy-1-[3-(2-hydroxyethylamino)-4-nitrophenyl]ethyl]sulfonylethanol.
| Compound Name | 2-[3-(2-hydroxyethylamino)-4-nitrophenyl]-2-[2-hydroxy-1-[3-(2-hydroxyethylamino)-4-nitrophenyl]ethyl]sulfonylethanol |
|---|---|
| PubChem CID | 54008960 |
| Molecular Formula | C20H26N4O10S |
| Molecular Weight | 514.51 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[3-(2-hydroxyethylamino)-4-nitrophenyl]-2-[2-hydroxy-1-[3-(2-hydroxyethylamino)-4-nitrophenyl]ethyl]sulfonylethanol |
| SMILES | O=[N+]([O-])c1ccc(C(CO)S(=O)(=O)C(CO)c2ccc([N+](=O)[O-])c(NCCO)c2)cc1NCCO |
| InChI | InChI=1S/C20H26N4O10S/c25-7-5-21-15-9-13(1-3-17(15)23(29)30)19(11-27)35(33,34)20(12-28)14-2-4-18(24(31)32)16(10-14)22-6-8-26/h1-4,9-10,19-22,25-28H,5-8,11-12H2 |
| InChIKey | KQXZAOWHXCHNRO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 225.40 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.51 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|