C8H9N — CID 54009157
3a,4-dihydro-1H-isoindole (PubChem CID 54009157) has the molecular formula C8H9N and a molecular weight of 119.17 g/mol. Its IUPAC name is 3a,4-dihydro-1H-isoindole.
| Compound Name | 3a,4-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 54009157 |
| Molecular Formula | C8H9N |
| Molecular Weight | 119.17 g/mol |
| Exact Mass | 119.07 |
| IUPAC Name | 3a,4-dihydro-1H-isoindole |
| SMILES | C1=CCC2C=NCC2=C1 |
| InChI | InChI=1S/C8H9N/c1-2-4-8-6-9-5-7(8)3-1/h1-3,6,8H,4-5H2 |
| InChIKey | KRBJEEYHQGBFSR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 119.17 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |