C9H11N — CID 90969446
4-methyl-7,7a-dihydro-1H-isoindole (PubChem CID 90969446) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 4-methyl-7,7a-dihydro-1H-isoindole.
| Compound Name | 4-methyl-7,7a-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 90969446 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 4-methyl-7,7a-dihydro-1H-isoindole |
| SMILES | CC1=C2C=NCC2CC=C1 |
| InChI | InChI=1S/C9H11N/c1-7-3-2-4-8-5-10-6-9(7)8/h2-3,6,8H,4-5H2,1H3 |
| InChIKey | DAOPXMOCZQTWHR-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |