C11H13N — CID 67987318
1,4-dimethyl-1,8a-dihydroisoquinoline (PubChem CID 67987318) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 1,4-dimethyl-1,8a-dihydroisoquinoline.
| Compound Name | 1,4-dimethyl-1,8a-dihydroisoquinoline |
|---|---|
| PubChem CID | 67987318 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 1,4-dimethyl-1,8a-dihydroisoquinoline |
| SMILES | CC1=C2C=CC=CC2C(C)N=C1 |
| InChI | InChI=1S/C11H13N/c1-8-7-12-9(2)11-6-4-3-5-10(8)11/h3-7,9,11H,1-2H3 |
| InChIKey | HNYBGJUMFWYLCV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |